C25H40N2O8 — CID 126573239
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[(2-hydroxy-2-methylpropyl)carbamoyloxy]azetidine-1-carboxylate (PubChem CID 126573239) has the molecular formula C25H40N2O8 and a molecular weight of 496.60 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[(2-hydroxy-2-methylpropyl)carbamoyloxy]azetidine-1-carboxylate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[(2-hydroxy-2-methylpropyl)carbamoyloxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 126573239 |
| Molecular Formula | C25H40N2O8 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[(2-hydroxy-2-methylpropyl)carbamoyloxy]azetidine-1-carboxylate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N2CC(OC(=O)NCC(C)(C)O)C2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C25H40N2O8/c1-15(2)7-8-18-24(5,35-18)20-19(31-6)17(9-10-25(20)14-32-25)34-22(29)27-11-16(12-27)33-21(28)26-13-23(3,4)30/h7,16-20,30H,8-14H2,1-6H3,(H,26,28)/t17-,18-,19-,20-,24+,25+/m1/s1 |
| InChIKey | BJBKSQYDLYJECJ-NWGRYQSDSA-N |
| XLogP | 2.38 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|