C29H46F2N2O5 — CID 126573266
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[2-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]azetidine-1-carboxylate (PubChem CID 126573266) has the molecular formula C29H46F2N2O5 and a molecular weight of 540.69 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[2-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]azetidine-1-carboxylate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[2-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 126573266 |
| Molecular Formula | C29H46F2N2O5 |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.34 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-[2-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]azetidine-1-carboxylate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N2CC(CCC3CCN(CC(F)F)CC3)C2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C29H46F2N2O5/c1-19(2)5-8-23-28(3,38-23)26-25(35-4)22(9-12-29(26)18-36-29)37-27(34)33-15-21(16-33)7-6-20-10-13-32(14-11-20)17-24(30)31/h5,20-26H,6-18H2,1-4H3/t22-,23-,25-,26-,28+,29+/m1/s1 |
| InChIKey | WMMOZHHRCIIDJE-UFRBKFNPSA-N |
| XLogP | 4.89 |
| TPSA | 67.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|