C21H32N2O7 — CID 126573314
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-carbamoyloxyazetidine-1-carboxylate (PubChem CID 126573314) has the molecular formula C21H32N2O7 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-carbamoyloxyazetidine-1-carboxylate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-carbamoyloxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 126573314 |
| Molecular Formula | C21H32N2O7 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-carbamoyloxyazetidine-1-carboxylate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N2CC(OC(N)=O)C2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C21H32N2O7/c1-12(2)5-6-15-20(3,30-15)17-16(26-4)14(7-8-21(17)11-27-21)29-19(25)23-9-13(10-23)28-18(22)24/h5,13-17H,6-11H2,1-4H3,(H2,22,24)/t14-,15-,16-,17-,20+,21+/m1/s1 |
| InChIKey | DLBDNKDHFGZSEP-LKTQXZJLSA-N |
| XLogP | 1.98 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|