C27H40F3N3O7 — CID 126573418
[1-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonyl]azetidin-3-yl] 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate (PubChem CID 126573418) has the molecular formula C27H40F3N3O7 and a molecular weight of 575.63 g/mol. Its IUPAC name is [1-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonyl]azetidin-3-yl] 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate.
| Compound Name | [1-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonyl]azetidin-3-yl] 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 126573418 |
| Molecular Formula | C27H40F3N3O7 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | [1-[[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonyl]azetidin-3-yl] 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N2CC(OC(=O)N3CCN(CC(F)(F)F)CC3)C2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C27H40F3N3O7/c1-17(2)5-6-20-25(3,40-20)22-21(36-4)19(7-8-26(22)16-37-26)39-24(35)33-13-18(14-33)38-23(34)32-11-9-31(10-12-32)15-27(28,29)30/h5,18-22H,6-16H2,1-4H3/t19-,20-,21-,22-,25+,26+/m1/s1 |
| InChIKey | GLHKMILNYHIGPM-RUNZLFIYSA-N |
| XLogP | 3.20 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|