About 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile
8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile (PubChem CID 126573765) has the molecular formula C7H5FN4
and a molecular weight of 164.14 g/mol. Its IUPAC name is 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile.
Molecular Properties
| Compound Name | 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile |
| PubChem CID | 126573765 |
| Molecular Formula | C7H5FN4 |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile |
| SMILES | N#Cc1cnc2n1CC=CN2F |
| InChI | InChI=1S/C7H5FN4/c8-12-3-1-2-11-6(4-9)5-10-7(11)12/h1,3,5H,2H2 |
| InChIKey | CYRNTAXWIWTCBT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile?
The IUPAC name of 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile (CID 126573765) is 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile.
What is the SMILES notation for 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile?
The canonical SMILES for 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile is N#Cc1cnc2n1CC=CN2F.
What is the InChIKey of 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile?
The InChIKey is CYRNTAXWIWTCBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN4/c8-12-3-1-2-11-6(4-9)5-10-7(11)12/h1,3,5H,2H2.
What are the key properties of 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile?
8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile has a molecular weight of 164.14 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5H-imidazo[1,2-a]pyrimidine-3-carbonitrile is sourced from PubChem (CID 126573765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).