About spiro[2.4]heptane
spiro[2.4]heptane (PubChem CID 12657448) has the molecular formula C7H12
and a molecular weight of 96.17 g/mol. Its IUPAC name is spiro[2.4]heptane.
Molecular Properties
| Compound Name | spiro[2.4]heptane |
| PubChem CID | 12657448 |
| Molecular Formula | C7H12 |
| Molecular Weight | 96.17 g/mol |
| Exact Mass | 96.09 |
| IUPAC Name | spiro[2.4]heptane |
| SMILES | C1CCC2(C1)CC2 |
| InChI | InChI=1S/C7H12/c1-2-4-7(3-1)5-6-7/h1-6H2 |
| InChIKey | HEMCGZPSGYRIOL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[2.4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.4]heptane?
The IUPAC name of spiro[2.4]heptane (CID 12657448) is spiro[2.4]heptane.
What is the SMILES notation for spiro[2.4]heptane?
The canonical SMILES for spiro[2.4]heptane is C1CCC2(C1)CC2.
What is the InChIKey of spiro[2.4]heptane?
The InChIKey is HEMCGZPSGYRIOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12/c1-2-4-7(3-1)5-6-7/h1-6H2.
What are the key properties of spiro[2.4]heptane?
spiro[2.4]heptane has a molecular weight of 96.17 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.4]heptane is sourced from PubChem (CID 12657448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).