About spiro[2.7]decane
spiro[2.7]decane (PubChem CID 12657449) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is spiro[2.7]decane.
Molecular Properties
| Compound Name | spiro[2.7]decane |
| PubChem CID | 12657449 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | spiro[2.7]decane |
| SMILES | C1CCCC2(CCC1)CC2 |
| InChI | InChI=1S/C10H18/c1-2-4-6-10(8-9-10)7-5-3-1/h1-9H2 |
| InChIKey | GRFNCVUXAVRLDP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[2.7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.7]decane?
The IUPAC name of spiro[2.7]decane (CID 12657449) is spiro[2.7]decane.
What is the SMILES notation for spiro[2.7]decane?
The canonical SMILES for spiro[2.7]decane is C1CCCC2(CCC1)CC2.
What is the InChIKey of spiro[2.7]decane?
The InChIKey is GRFNCVUXAVRLDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18/c1-2-4-6-10(8-9-10)7-5-3-1/h1-9H2.
What are the key properties of spiro[2.7]decane?
spiro[2.7]decane has a molecular weight of 138.25 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.7]decane is sourced from PubChem (CID 12657449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).