C29H35N3O11 — CID 126574826
[1-[3-[(4S,4aS,5aS,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-2-yl]-3-oxopropyl]piperidin-4-yl] nitrate (PubChem CID 126574826) has the molecular formula C29H35N3O11 and a molecular weight of 601.61 g/mol. Its IUPAC name is [1-[3-[(4S,4aS,5aS,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-2-yl]-3-oxopropyl]piperidin-4-yl] nitrate.
| Compound Name | [1-[3-[(4S,4aS,5aS,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-2-yl]-3-oxopropyl]piperidin-4-yl] nitrate |
|---|---|
| PubChem CID | 126574826 |
| Molecular Formula | C29H35N3O11 |
| Molecular Weight | 601.61 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | [1-[3-[(4S,4aS,5aS,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracen-2-yl]-3-oxopropyl]piperidin-4-yl] nitrate |
| SMILES | CN(C)[C@@H]1C(=O)C(C(=O)CCN2CCC(O[N+](=O)[O-])CC2)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4C(C)(O)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C29H35N3O11/c1-28(39)15-5-4-6-18(33)20(15)24(35)21-16(28)13-17-23(30(2)3)25(36)22(27(38)29(17,40)26(21)37)19(34)9-12-31-10-7-14(8-11-31)43-32(41)42/h4-6,14,16-17,23,33,35,38-40H,7-13H2,1-3H3/t16-,17-,23-,28?,29-/m0/s1 |
| InChIKey | XAOCYIIFGJGZKX-SYQGBUSTSA-N |
| XLogP | 0.78 |
| TPSA | 211.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.61 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|