C26H26N2O3S — CID 126575010
(4-methylphenyl) 2-(3-methyl-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-2-yl)sulfanylacetate (PubChem CID 126575010) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is (4-methylphenyl) 2-(3-methyl-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-2-yl)sulfanylacetate.
| Compound Name | (4-methylphenyl) 2-(3-methyl-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 126575010 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (4-methylphenyl) 2-(3-methyl-4-oxospiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-2-yl)sulfanylacetate |
| SMILES | Cc1ccc(OC(=O)CSc2nc3c(c(=O)n2C)C2(CCCC2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-17-9-11-19(12-10-17)31-21(29)16-32-25-27-23-20-8-4-3-7-18(20)15-26(13-5-6-14-26)22(23)24(30)28(25)2/h3-4,7-12H,5-6,13-16H2,1-2H3 |
| InChIKey | AVUARRCHNDOOSB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|