C12H25N3O2 — CID 126575146
1-(3,3-dimethylbutyl)-3-(2,2-dimethylpropanoylamino)urea (PubChem CID 126575146) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-(2,2-dimethylpropanoylamino)urea.
| Compound Name | 1-(3,3-dimethylbutyl)-3-(2,2-dimethylpropanoylamino)urea |
|---|---|
| PubChem CID | 126575146 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-(2,2-dimethylpropanoylamino)urea |
| SMILES | CC(C)(C)CCNC(=O)NNC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H25N3O2/c1-11(2,3)7-8-13-10(17)15-14-9(16)12(4,5)6/h7-8H2,1-6H3,(H,14,16)(H2,13,15,17) |
| InChIKey | YGKLKJGYNPYRNT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|