About methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate
methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate (PubChem CID 126575252) has the molecular formula C15H16INO3S
and a molecular weight of 417.27 g/mol. Its IUPAC name is methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate |
| PubChem CID | 126575252 |
| Molecular Formula | C15H16INO3S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate |
| SMILES | COC(=O)c1ccc([C@@H]2CC[C@H](O)C2)c2ccn(SI)c12 |
| InChI | InChI=1S/C15H16INO3S/c1-20-15(19)13-5-4-11(9-2-3-10(18)8-9)12-6-7-17(21-16)14(12)13/h4-7,9-10,18H,2-3,8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | AAQXASWLCPFBAS-ZJUUUORDSA-N |
| XLogP | 3.90 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate?
The IUPAC name of methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate (CID 126575252) is methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate.
What is the SMILES notation for methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate?
The canonical SMILES for methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate is COC(=O)c1ccc([C@@H]2CC[C@H](O)C2)c2ccn(SI)c12.
What is the InChIKey of methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate?
The InChIKey is AAQXASWLCPFBAS-ZJUUUORDSA-N. The full InChI is InChI=1S/C15H16INO3S/c1-20-15(19)13-5-4-11(9-2-3-10(18)8-9)12-6-7-17(21-16)14(12)13/h4-7,9-10,18H,2-3,8H2,1H3/t9-,10+/m1/s1.
What are the key properties of methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate?
methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate has a molecular weight of 417.27 g/mol, XLogP of 3.90, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1R,3S)-3-hydroxycyclopentyl]-1-iodosulfanylindole-7-carboxylate is sourced from PubChem (CID 126575252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).