C11H18F4O4S — CID 126575306
(4-ethylsulfonyl-3,3,4,4-tetrafluorobutyl) 2,2-dimethylpropanoate (PubChem CID 126575306) has the molecular formula C11H18F4O4S and a molecular weight of 322.32 g/mol. Its IUPAC name is (4-ethylsulfonyl-3,3,4,4-tetrafluorobutyl) 2,2-dimethylpropanoate.
| Compound Name | (4-ethylsulfonyl-3,3,4,4-tetrafluorobutyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 126575306 |
| Molecular Formula | C11H18F4O4S |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (4-ethylsulfonyl-3,3,4,4-tetrafluorobutyl) 2,2-dimethylpropanoate |
| SMILES | CCS(=O)(=O)C(F)(F)C(F)(F)CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H18F4O4S/c1-5-20(17,18)11(14,15)10(12,13)6-7-19-8(16)9(2,3)4/h5-7H2,1-4H3 |
| InChIKey | HNJOYAQNAIEPCW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|