C24H22F4O8S2 — CID 126575317
2-[4-[2-[2-(6-ethenylnaphthalen-2-yl)oxyethoxy]ethyl]phenoxy]sulfonyl-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 126575317) has the molecular formula C24H22F4O8S2 and a molecular weight of 578.56 g/mol. Its IUPAC name is 2-[4-[2-[2-(6-ethenylnaphthalen-2-yl)oxyethoxy]ethyl]phenoxy]sulfonyl-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[4-[2-[2-(6-ethenylnaphthalen-2-yl)oxyethoxy]ethyl]phenoxy]sulfonyl-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 126575317 |
| Molecular Formula | C24H22F4O8S2 |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | 2-[4-[2-[2-(6-ethenylnaphthalen-2-yl)oxyethoxy]ethyl]phenoxy]sulfonyl-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | C=Cc1ccc2cc(OCCOCCc3ccc(OS(=O)(=O)C(F)(F)C(F)(F)S(=O)(=O)O)cc3)ccc2c1 |
| InChI | InChI=1S/C24H22F4O8S2/c1-2-17-3-6-20-16-22(10-7-19(20)15-17)35-14-13-34-12-11-18-4-8-21(9-5-18)36-38(32,33)24(27,28)23(25,26)37(29,30)31/h2-10,15-16H,1,11-14H2,(H,29,30,31) |
| InChIKey | UYSVWNVNFGVONL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|