About N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine
N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine (PubChem CID 126575397) has the molecular formula C15H31N
and a molecular weight of 225.42 g/mol. Its IUPAC name is N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine.
Molecular Properties
| Compound Name | N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine |
| PubChem CID | 126575397 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine |
| SMILES | C=C(CC(C)(C)C)NC(C)(C)CCC(C)C |
| InChI | InChI=1S/C15H31N/c1-12(2)9-10-15(7,8)16-13(3)11-14(4,5)6/h12,16H,3,9-11H2,1-2,4-8H3 |
| InChIKey | LLHYJAKSVHLRNM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine?
The IUPAC name of N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine (CID 126575397) is N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine.
What is the SMILES notation for N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine?
The canonical SMILES for N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine is C=C(CC(C)(C)C)NC(C)(C)CCC(C)C.
What is the InChIKey of N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine?
The InChIKey is LLHYJAKSVHLRNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N/c1-12(2)9-10-15(7,8)16-13(3)11-14(4,5)6/h12,16H,3,9-11H2,1-2,4-8H3.
What are the key properties of N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine?
N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine has a molecular weight of 225.42 g/mol, XLogP of 4.74, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylpent-1-en-2-yl)-2,5-dimethylhexan-2-amine is sourced from PubChem (CID 126575397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).