C4H5NO4 — CID 126575623
(3R,4R)-3,4-dihydroxypyrrolidine-2,5-dione (PubChem CID 126575623) has the molecular formula C4H5NO4 and a molecular weight of 131.09 g/mol. Its IUPAC name is (3R,4R)-3,4-dihydroxypyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-3,4-dihydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 126575623 |
| Molecular Formula | C4H5NO4 |
| Molecular Weight | 131.09 g/mol |
| Exact Mass | 131.02 |
| IUPAC Name | (3R,4R)-3,4-dihydroxypyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C4H5NO4/c6-1-2(7)4(9)5-3(1)8/h1-2,6-7H,(H,5,8,9)/t1-,2-/m1/s1 |
| InChIKey | MPTQLFFTNNKMRP-JCYAYHJZSA-N |
| XLogP | -2.64 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.09 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|