C11H14O2 — CID 12657570
(3S,6R)-tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-diol (PubChem CID 12657570) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (3S,6R)-tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-diol.
| Compound Name | (3S,6R)-tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-diol |
|---|---|
| PubChem CID | 12657570 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (3S,6R)-tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-diol |
| SMILES | OC1C=CC(O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C11H14O2/c12-8-3-4-9(13)11-7-2-1-6(5-7)10(8)11/h1-4,6-13H,5H2 |
| InChIKey | WQYPBLXNPXDCOZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|