C16H18O2 — CID 126576109
(2E,3E)-2,3-di(ethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyran-4-one (PubChem CID 126576109) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (2E,3E)-2,3-di(ethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyran-4-one.
| Compound Name | (2E,3E)-2,3-di(ethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyran-4-one |
|---|---|
| PubChem CID | 126576109 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (2E,3E)-2,3-di(ethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyran-4-one |
| SMILES | C=C/C=C(\C=C/C)c1cc(=O)c(=C/C)/c(=C\C)o1 |
| InChI | InChI=1S/C16H18O2/c1-5-9-12(10-6-2)16-11-14(17)13(7-3)15(8-4)18-16/h5-11H,1H2,2-4H3/b10-6-,12-9+,13-7-,15-8+ |
| InChIKey | NABLFWWLPBBKMH-HOBFJBDHSA-N |
| XLogP | 2.39 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|