About 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine
5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine (PubChem CID 126576136) has the molecular formula C8H7BrFNO2
and a molecular weight of 248.05 g/mol. Its IUPAC name is 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine.
Molecular Properties
| Compound Name | 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine |
| PubChem CID | 126576136 |
| Molecular Formula | C8H7BrFNO2 |
| Molecular Weight | 248.05 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine |
| SMILES | Fc1ncc(Br)cc1C1OCCO1 |
| InChI | InChI=1S/C8H7BrFNO2/c9-5-3-6(7(10)11-4-5)8-12-1-2-13-8/h3-4,8H,1-2H2 |
| InChIKey | RZDLEWCKOXQQLV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.05 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine?
The IUPAC name of 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine (CID 126576136) is 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine.
What is the SMILES notation for 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine?
The canonical SMILES for 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine is Fc1ncc(Br)cc1C1OCCO1.
What is the InChIKey of 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine?
The InChIKey is RZDLEWCKOXQQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrFNO2/c9-5-3-6(7(10)11-4-5)8-12-1-2-13-8/h3-4,8H,1-2H2.
What are the key properties of 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine?
5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine has a molecular weight of 248.05 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(1,3-dioxolan-2-yl)-2-fluoropyridine is sourced from PubChem (CID 126576136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).