C12H20N2O4S — CID 126576514
methyl 5-[(3aS,4S,6aR)-2-methylidene-5,5-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 126576514) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is methyl 5-[(3aS,4S,6aR)-2-methylidene-5,5-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | methyl 5-[(3aS,4S,6aR)-2-methylidene-5,5-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 126576514 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | methyl 5-[(3aS,4S,6aR)-2-methylidene-5,5-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | C=C1N[C@H]2[C@H](CS(=O)(=O)[C@H]2CCCCC(=O)OC)N1 |
| InChI | InChI=1S/C12H20N2O4S/c1-8-13-9-7-19(16,17)10(12(9)14-8)5-3-4-6-11(15)18-2/h9-10,12-14H,1,3-7H2,2H3/t9-,10-,12-/m0/s1 |
| InChIKey | GOWNCAYYHGBSJU-NHCYSSNCSA-N |
| XLogP | -0.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|