C27H33ClN6O3 — CID 126576995
1-[(3aS,6aR)-2-[2-[6-(2-chloro-3,5-dimethoxyphenyl)-2-(methylamino)-7H-pyrido[2,3-d]pyrimidin-8-yl]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one (PubChem CID 126576995) has the molecular formula C27H33ClN6O3 and a molecular weight of 525.05 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2-[2-[6-(2-chloro-3,5-dimethoxyphenyl)-2-(methylamino)-7H-pyrido[2,3-d]pyrimidin-8-yl]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one.
| Compound Name | 1-[(3aS,6aR)-2-[2-[6-(2-chloro-3,5-dimethoxyphenyl)-2-(methylamino)-7H-pyrido[2,3-d]pyrimidin-8-yl]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 126576995 |
| Molecular Formula | C27H33ClN6O3 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 1-[(3aS,6aR)-2-[2-[6-(2-chloro-3,5-dimethoxyphenyl)-2-(methylamino)-7H-pyrido[2,3-d]pyrimidin-8-yl]ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H]2CN(CCN3CC(c4cc(OC)cc(OC)c4Cl)=Cc4cnc(NC)nc43)C[C@H]2C1 |
| InChI | InChI=1S/C27H33ClN6O3/c1-5-24(35)34-15-19-12-32(13-20(19)16-34)6-7-33-14-18(8-17-11-30-27(29-2)31-26(17)33)22-9-21(36-3)10-23(37-4)25(22)28/h5,8-11,19-20H,1,6-7,12-16H2,2-4H3,(H,29,30,31)/t19-,20+ |
| InChIKey | KYXJRBHGMYXOCD-BGYRXZFFSA-N |
| XLogP | 3.13 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|