C24H26N6O2S2 — CID 126577287
1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-[(2-pyrrol-1-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methyl]urea (PubChem CID 126577287) has the molecular formula C24H26N6O2S2 and a molecular weight of 494.65 g/mol. Its IUPAC name is 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-[(2-pyrrol-1-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methyl]urea.
| Compound Name | 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-[(2-pyrrol-1-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 126577287 |
| Molecular Formula | C24H26N6O2S2 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 1-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-[(2-pyrrol-1-yl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl)methyl]urea |
| SMILES | Cc1noc(-c2c(NC(=O)NCc3c(-n4cccc4)sc4c3CCNC4)sc3c2CCCC3)n1 |
| InChI | InChI=1S/C24H26N6O2S2/c1-14-27-21(32-29-14)20-16-6-2-3-7-18(16)33-22(20)28-24(31)26-12-17-15-8-9-25-13-19(15)34-23(17)30-10-4-5-11-30/h4-5,10-11,25H,2-3,6-9,12-13H2,1H3,(H2,26,28,31) |
| InChIKey | ODSFKYUTYIUSFQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |