C27H31FN4O3S2 — CID 126577290
tert-butyl 2-[[2-(6-fluoro-3-pyridinyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126577290) has the molecular formula C27H31FN4O3S2 and a molecular weight of 542.70 g/mol. Its IUPAC name is tert-butyl 2-[[2-(6-fluoro-3-pyridinyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | tert-butyl 2-[[2-(6-fluoro-3-pyridinyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126577290 |
| Molecular Formula | C27H31FN4O3S2 |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | tert-butyl 2-[[2-(6-fluoro-3-pyridinyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(NC(=O)NCc2c(-c3ccc(F)nc3)sc3c2CCNC3)sc2c1CCCC2 |
| InChI | InChI=1S/C27H31FN4O3S2/c1-27(2,3)35-25(33)22-17-6-4-5-7-19(17)37-24(22)32-26(34)31-13-18-16-10-11-29-14-20(16)36-23(18)15-8-9-21(28)30-12-15/h8-9,12,29H,4-7,10-11,13-14H2,1-3H3,(H2,31,32,34) |
| InChIKey | FFNFVFGHPNCXAQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|