About N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine
N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine (PubChem CID 126578125) has the molecular formula C10H19N5
and a molecular weight of 209.30 g/mol. Its IUPAC name is N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine.
Molecular Properties
| Compound Name | N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine |
| PubChem CID | 126578125 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine |
| SMILES | CNC1CCN(Cc2ncn(C)n2)CC1 |
| InChI | InChI=1S/C10H19N5/c1-11-9-3-5-15(6-4-9)7-10-12-8-14(2)13-10/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | FRGPHMLHMPXLKO-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine?
The IUPAC name of N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine (CID 126578125) is N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine.
What is the SMILES notation for N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine?
The canonical SMILES for N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine is CNC1CCN(Cc2ncn(C)n2)CC1.
What is the InChIKey of N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine?
The InChIKey is FRGPHMLHMPXLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5/c1-11-9-3-5-15(6-4-9)7-10-12-8-14(2)13-10/h8-9,11H,3-7H2,1-2H3.
What are the key properties of N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine?
N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine has a molecular weight of 209.30 g/mol, XLogP of -0.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-amine is sourced from PubChem (CID 126578125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).