C21H36O4 — CID 126578276
6-prop-2-enoyloxyhexyl 4-pentylcyclohexane-1-carboxylate (PubChem CID 126578276) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 6-prop-2-enoyloxyhexyl 4-pentylcyclohexane-1-carboxylate.
| Compound Name | 6-prop-2-enoyloxyhexyl 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 126578276 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 6-prop-2-enoyloxyhexyl 4-pentylcyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)C1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C21H36O4/c1-3-5-8-11-18-12-14-19(15-13-18)21(23)25-17-10-7-6-9-16-24-20(22)4-2/h4,18-19H,2-3,5-17H2,1H3 |
| InChIKey | JFSGKXFTCBDZFX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|