C37H47N5O2 — CID 126578312
1,3-bis[7,7-dimethyl-2-(oxan-2-yl)-5,6-dihydro-4H-indazol-3-yl]isoquinoline (PubChem CID 126578312) has the molecular formula C37H47N5O2 and a molecular weight of 593.82 g/mol. Its IUPAC name is 1,3-bis[7,7-dimethyl-2-(oxan-2-yl)-5,6-dihydro-4H-indazol-3-yl]isoquinoline.
| Compound Name | 1,3-bis[7,7-dimethyl-2-(oxan-2-yl)-5,6-dihydro-4H-indazol-3-yl]isoquinoline |
|---|---|
| PubChem CID | 126578312 |
| Molecular Formula | C37H47N5O2 |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 593.37 |
| IUPAC Name | 1,3-bis[7,7-dimethyl-2-(oxan-2-yl)-5,6-dihydro-4H-indazol-3-yl]isoquinoline |
| SMILES | CC1(C)CCCc2c1nn(C1CCCCO1)c2-c1cc2ccccc2c(-c2c3c(nn2C2CCCCO2)C(C)(C)CCC3)n1 |
| InChI | InChI=1S/C37H47N5O2/c1-36(2)19-11-15-26-32(41(39-34(26)36)29-17-7-9-21-43-29)28-23-24-13-5-6-14-25(24)31(38-28)33-27-16-12-20-37(3,4)35(27)40-42(33)30-18-8-10-22-44-30/h5-6,13-14,23,29-30H,7-12,15-22H2,1-4H3 |
| InChIKey | LNIGIPTUFBHUGB-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |