C43H61N5O2 — CID 126578323
2,6-bis[3-tert-butyl-1-(oxan-2-yl)pyrazol-5-yl]-4-(3,5-ditert-butylphenyl)pyridine (PubChem CID 126578323) has the molecular formula C43H61N5O2 and a molecular weight of 679.99 g/mol. Its IUPAC name is 2,6-bis[3-tert-butyl-1-(oxan-2-yl)pyrazol-5-yl]-4-(3,5-ditert-butylphenyl)pyridine.
| Compound Name | 2,6-bis[3-tert-butyl-1-(oxan-2-yl)pyrazol-5-yl]-4-(3,5-ditert-butylphenyl)pyridine |
|---|---|
| PubChem CID | 126578323 |
| Molecular Formula | C43H61N5O2 |
| Molecular Weight | 679.99 g/mol |
| Exact Mass | 679.48 |
| IUPAC Name | 2,6-bis[3-tert-butyl-1-(oxan-2-yl)pyrazol-5-yl]-4-(3,5-ditert-butylphenyl)pyridine |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc(C(C)(C)C)nn3C3CCCCO3)nc(-c3cc(C(C)(C)C)nn3C3CCCCO3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C43H61N5O2/c1-40(2,3)30-21-28(22-31(25-30)41(4,5)6)29-23-32(34-26-36(42(7,8)9)45-47(34)38-17-13-15-19-49-38)44-33(24-29)35-27-37(43(10,11)12)46-48(35)39-18-14-16-20-50-39/h21-27,38-39H,13-20H2,1-12H3 |
| InChIKey | ZOGAZSZTENALPQ-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.99 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |