C31H54O2 — CID 126578467
[4,4-dimethyl-1-[(E)-7-methylhexadec-8-enoxy]pentan-2-yl]oxymethylbenzene (PubChem CID 126578467) has the molecular formula C31H54O2 and a molecular weight of 458.77 g/mol. Its IUPAC name is [4,4-dimethyl-1-[(E)-7-methylhexadec-8-enoxy]pentan-2-yl]oxymethylbenzene.
| Compound Name | [4,4-dimethyl-1-[(E)-7-methylhexadec-8-enoxy]pentan-2-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 126578467 |
| Molecular Formula | C31H54O2 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.41 |
| IUPAC Name | [4,4-dimethyl-1-[(E)-7-methylhexadec-8-enoxy]pentan-2-yl]oxymethylbenzene |
| SMILES | CCCCCCC/C=C/C(C)CCCCCCOCC(CC(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C31H54O2/c1-6-7-8-9-10-11-15-20-28(2)21-16-12-13-19-24-32-27-30(25-31(3,4)5)33-26-29-22-17-14-18-23-29/h14-15,17-18,20,22-23,28,30H,6-13,16,19,21,24-27H2,1-5H3/b20-15+ |
| InChIKey | VGEPVEHEYXTJIZ-HMMYKYKNSA-N |
| XLogP | 9.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|