C46H27N5O — CID 126580295
3-[4-[4-(3-dibenzofuran-4-ylcarbazol-9-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 126580295) has the molecular formula C46H27N5O and a molecular weight of 665.76 g/mol. Its IUPAC name is 3-[4-[4-(3-dibenzofuran-4-ylcarbazol-9-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 3-[4-[4-(3-dibenzofuran-4-ylcarbazol-9-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 126580295 |
| Molecular Formula | C46H27N5O |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.22 |
| IUPAC Name | 3-[4-[4-(3-dibenzofuran-4-ylcarbazol-9-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5cc(-c6cccc7c6oc6ccccc67)ccc54)cc3)n2)c1 |
| InChI | InChI=1S/C46H27N5O/c47-28-29-10-8-13-33(26-29)46-49-44(30-11-2-1-3-12-30)48-45(50-46)31-20-23-34(24-21-31)51-40-18-6-4-14-36(40)39-27-32(22-25-41(39)51)35-16-9-17-38-37-15-5-7-19-42(37)52-43(35)38/h1-27H |
| InChIKey | SJDZBTXUKNQJOB-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 80.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |