C15H26O — CID 126580616
(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)-2-[(1S,2R)-2-methylcyclohexyl]oxirane (PubChem CID 126580616) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-(3-methylbut-2-enyl)-2-[(1S,2R)-2-methylcyclohexyl]oxirane.
| Compound Name | (2R,3R)-2-methyl-3-(3-methylbut-2-enyl)-2-[(1S,2R)-2-methylcyclohexyl]oxirane |
|---|---|
| PubChem CID | 126580616 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (2R,3R)-2-methyl-3-(3-methylbut-2-enyl)-2-[(1S,2R)-2-methylcyclohexyl]oxirane |
| SMILES | CC(C)=CC[C@H]1O[C@]1(C)[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C15H26O/c1-11(2)9-10-14-15(4,16-14)13-8-6-5-7-12(13)3/h9,12-14H,5-8,10H2,1-4H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | WSYWKAIDNVDOOV-LXTVHRRPSA-N |
| XLogP | 4.33 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|