C26H40F2N2O5 — CID 126580694
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (3R)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 126580694) has the molecular formula C26H40F2N2O5 and a molecular weight of 498.61 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (3R)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (3R)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126580694 |
| Molecular Formula | C26H40F2N2O5 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (3R)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CO[C@@H]1[C@H](OC(=O)N2CC[C@@H](CCN3CC(F)(F)C3)C2)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C26H40F2N2O5/c1-17(2)5-6-20-24(3,35-20)22-21(32-4)19(7-10-25(22)16-33-25)34-23(31)30-12-9-18(13-30)8-11-29-14-26(27,28)15-29/h5,18-22H,6-16H2,1-4H3/t18-,19-,20-,21-,22-,24+,25+/m1/s1 |
| InChIKey | YWMFIBCMMFJPJA-FNAXAVMJSA-N |
| XLogP | 3.86 |
| TPSA | 67.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|