About (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine
(3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine (PubChem CID 126580701) has the molecular formula C9H16F2N2
and a molecular weight of 190.24 g/mol. Its IUPAC name is (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine.
Molecular Properties
| Compound Name | (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine |
| PubChem CID | 126580701 |
| Molecular Formula | C9H16F2N2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine |
| SMILES | FC1(F)CN(CC[C@@H]2CCNC2)C1 |
| InChI | InChI=1S/C9H16F2N2/c10-9(11)6-13(7-9)4-2-8-1-3-12-5-8/h8,12H,1-7H2/t8-/m0/s1 |
| InChIKey | PMPPOPGPYJAKPT-QMMMGPOBSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine?
The IUPAC name of (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine (CID 126580701) is (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine.
What is the SMILES notation for (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine?
The canonical SMILES for (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine is FC1(F)CN(CC[C@@H]2CCNC2)C1.
What is the InChIKey of (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine?
The InChIKey is PMPPOPGPYJAKPT-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H16F2N2/c10-9(11)6-13(7-9)4-2-8-1-3-12-5-8/h8,12H,1-7H2/t8-/m0/s1.
What are the key properties of (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine?
(3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine has a molecular weight of 190.24 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine is sourced from PubChem (CID 126580701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).