About 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane
7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane (PubChem CID 126580710) has the molecular formula C18H35F3O
and a molecular weight of 324.47 g/mol. Its IUPAC name is 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane.
Molecular Properties
| Compound Name | 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane |
| PubChem CID | 126580710 |
| Molecular Formula | C18H35F3O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane |
| SMILES | CCCCCCCC(C)(CCCCCC)O[C@@H](C)C(F)(F)F |
| InChI | InChI=1S/C18H35F3O/c1-5-7-9-11-13-15-17(4,14-12-10-8-6-2)22-16(3)18(19,20)21/h16H,5-15H2,1-4H3/t16-,17?/m0/s1 |
| InChIKey | IKVYGQLYAPESJN-BHWOMJMDSA-N |
| XLogP | 7.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane?
The IUPAC name of 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane (CID 126580710) is 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane.
What is the SMILES notation for 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane?
The canonical SMILES for 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane is CCCCCCCC(C)(CCCCCC)O[C@@H](C)C(F)(F)F.
What is the InChIKey of 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane?
The InChIKey is IKVYGQLYAPESJN-BHWOMJMDSA-N. The full InChI is InChI=1S/C18H35F3O/c1-5-7-9-11-13-15-17(4,14-12-10-8-6-2)22-16(3)18(19,20)21/h16H,5-15H2,1-4H3/t16-,17?/m0/s1.
What are the key properties of 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane?
7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane has a molecular weight of 324.47 g/mol, XLogP of 7.04, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-7-[(2S)-1,1,1-trifluoropropan-2-yl]oxytetradecane is sourced from PubChem (CID 126580710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).