About 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine
1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine (PubChem CID 126580777) has the molecular formula C9H16F2N2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine.
Molecular Properties
| Compound Name | 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine |
| PubChem CID | 126580777 |
| Molecular Formula | C9H16F2N2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine |
| SMILES | FC1(F)CCN(CCC2CNC2)C1 |
| InChI | InChI=1S/C9H16F2N2/c10-9(11)2-4-13(7-9)3-1-8-5-12-6-8/h8,12H,1-7H2 |
| InChIKey | YQMGONZOBAXPAR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine?
The IUPAC name of 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine (CID 126580777) is 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine.
What is the SMILES notation for 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine?
The canonical SMILES for 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine is FC1(F)CCN(CCC2CNC2)C1.
What is the InChIKey of 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine?
The InChIKey is YQMGONZOBAXPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2/c10-9(11)2-4-13(7-9)3-1-8-5-12-6-8/h8,12H,1-7H2.
What are the key properties of 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine?
1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine has a molecular weight of 190.24 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(azetidin-3-yl)ethyl]-3,3-difluoropyrrolidine is sourced from PubChem (CID 126580777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).