C10H15N3 — CID 126581046
5-buta-1,3-dien-2-yl-1-methyl-3-propyl-1,2,4-triazole (PubChem CID 126581046) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yl-1-methyl-3-propyl-1,2,4-triazole.
| Compound Name | 5-buta-1,3-dien-2-yl-1-methyl-3-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 126581046 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 5-buta-1,3-dien-2-yl-1-methyl-3-propyl-1,2,4-triazole |
| SMILES | C=CC(=C)c1nc(CCC)nn1C |
| InChI | InChI=1S/C10H15N3/c1-5-7-9-11-10(8(3)6-2)13(4)12-9/h6H,2-3,5,7H2,1,4H3 |
| InChIKey | BJRMPFBWWKOQCY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|