About ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate
ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate (PubChem CID 126581376) has the molecular formula C23H19F2NO6
and a molecular weight of 443.40 g/mol. Its IUPAC name is ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate |
| PubChem CID | 126581376 |
| Molecular Formula | C23H19F2NO6 |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate |
| SMILES | CCOC(=O)c1occ(C(=O)NCc2ccc(F)cc2F)c(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H19F2NO6/c1-2-30-23(29)21-20(31-12-14-6-4-3-5-7-14)19(27)17(13-32-21)22(28)26-11-15-8-9-16(24)10-18(15)25/h3-10,13H,2,11-12H2,1H3,(H,26,28) |
| InChIKey | RYOOXIAAFSTSKG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate?
The IUPAC name of ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate (CID 126581376) is ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate.
What is the SMILES notation for ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate?
The canonical SMILES for ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate is CCOC(=O)c1occ(C(=O)NCc2ccc(F)cc2F)c(=O)c1OCc1ccccc1.
What is the InChIKey of ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate?
The InChIKey is RYOOXIAAFSTSKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F2NO6/c1-2-30-23(29)21-20(31-12-14-6-4-3-5-7-14)19(27)17(13-32-21)22(28)26-11-15-8-9-16(24)10-18(15)25/h3-10,13H,2,11-12H2,1H3,(H,26,28).
What are the key properties of ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate?
ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate has a molecular weight of 443.40 g/mol, XLogP of 3.60, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyran-2-carboxylate is sourced from PubChem (CID 126581376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).