C26H28N2O3 — CID 126581638
(9R)-17-(cyclopropylmethyl)-4-hydroxy-12-[(4-hydroxyphenyl)methyl]-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-13-one (PubChem CID 126581638) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is (9R)-17-(cyclopropylmethyl)-4-hydroxy-12-[(4-hydroxyphenyl)methyl]-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-13-one.
| Compound Name | (9R)-17-(cyclopropylmethyl)-4-hydroxy-12-[(4-hydroxyphenyl)methyl]-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 126581638 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (9R)-17-(cyclopropylmethyl)-4-hydroxy-12-[(4-hydroxyphenyl)methyl]-12,17-diazatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,10-tetraen-13-one |
| SMILES | O=C1CC23CCN(CC4CC4)[C@H](Cc4ccc(O)cc42)C3=CN1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C26H28N2O3/c29-20-6-3-18(4-7-20)15-28-16-23-24-11-19-5-8-21(30)12-22(19)26(23,13-25(28)31)9-10-27(24)14-17-1-2-17/h3-8,12,16-17,24,29-30H,1-2,9-11,13-15H2/t24-,26?/m1/s1 |
| InChIKey | IGZBIWQCMVZOKV-RMVMEJTISA-N |
| XLogP | 3.69 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |