About [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate
[4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate (PubChem CID 126581719) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate.
Molecular Properties
| Compound Name | [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate |
| PubChem CID | 126581719 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate |
| SMILES | N#COC1=CC=C(CN)CC=C1 |
| InChI | InChI=1S/C9H10N2O/c10-6-8-2-1-3-9(5-4-8)12-7-11/h1,3-5H,2,6,10H2 |
| InChIKey | FPFFIPSIVBSSGG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate?
The IUPAC name of [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate (CID 126581719) is [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate.
What is the SMILES notation for [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate?
The canonical SMILES for [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate is N#COC1=CC=C(CN)CC=C1.
What is the InChIKey of [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate?
The InChIKey is FPFFIPSIVBSSGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c10-6-8-2-1-3-9(5-4-8)12-7-11/h1,3-5H,2,6,10H2.
What are the key properties of [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate?
[4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate has a molecular weight of 162.19 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)cyclohepta-1,3,6-trien-1-yl] cyanate is sourced from PubChem (CID 126581719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).