C24H35NO2 — CID 126581821
(5S,8R)-8-[6-(5-methoxypentyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1-azaspiro[4.4]nonan-2-one (PubChem CID 126581821) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is (5S,8R)-8-[6-(5-methoxypentyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1-azaspiro[4.4]nonan-2-one.
| Compound Name | (5S,8R)-8-[6-(5-methoxypentyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1-azaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 126581821 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | (5S,8R)-8-[6-(5-methoxypentyl)-5,6,7,8-tetrahydronaphthalen-2-yl]-1-azaspiro[4.4]nonan-2-one |
| SMILES | COCCCCCC1CCc2cc([C@@H]3CC[C@]4(CCC(=O)N4)C3)ccc2C1 |
| InChI | InChI=1S/C24H35NO2/c1-27-14-4-2-3-5-18-6-7-20-16-21(9-8-19(20)15-18)22-10-12-24(17-22)13-11-23(26)25-24/h8-9,16,18,22H,2-7,10-15,17H2,1H3,(H,25,26)/t18?,22-,24+/m1/s1 |
| InChIKey | PCVYYMNKJCIXEB-ZMOSESBSSA-N |
| XLogP | 4.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|