C23H34N6O — CID 126581989
2-butoxy-8-[1-[4-(pyrrolidin-1-ylmethyl)phenyl]ethyl]-6,7-dihydro-5H-pteridin-4-amine (PubChem CID 126581989) has the molecular formula C23H34N6O and a molecular weight of 410.57 g/mol. Its IUPAC name is 2-butoxy-8-[1-[4-(pyrrolidin-1-ylmethyl)phenyl]ethyl]-6,7-dihydro-5H-pteridin-4-amine.
| Compound Name | 2-butoxy-8-[1-[4-(pyrrolidin-1-ylmethyl)phenyl]ethyl]-6,7-dihydro-5H-pteridin-4-amine |
|---|---|
| PubChem CID | 126581989 |
| Molecular Formula | C23H34N6O |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 2-butoxy-8-[1-[4-(pyrrolidin-1-ylmethyl)phenyl]ethyl]-6,7-dihydro-5H-pteridin-4-amine |
| SMILES | CCCCOc1nc(N)c2c(n1)N(C(C)c1ccc(CN3CCCC3)cc1)CCN2 |
| InChI | InChI=1S/C23H34N6O/c1-3-4-15-30-23-26-21(24)20-22(27-23)29(14-11-25-20)17(2)19-9-7-18(8-10-19)16-28-12-5-6-13-28/h7-10,17,25H,3-6,11-16H2,1-2H3,(H2,24,26,27) |
| InChIKey | UHBLWMKNIQTJON-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|