C23H22F3N5O2S2 — CID 126582797
N-[(5E)-5-(benzoylhydrazinylidene)-6,6,6-trifluorohexyl]-5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 126582797) has the molecular formula C23H22F3N5O2S2 and a molecular weight of 521.59 g/mol. Its IUPAC name is N-[(5E)-5-(benzoylhydrazinylidene)-6,6,6-trifluorohexyl]-5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(5E)-5-(benzoylhydrazinylidene)-6,6,6-trifluorohexyl]-5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126582797 |
| Molecular Formula | C23H22F3N5O2S2 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | N-[(5E)-5-(benzoylhydrazinylidene)-6,6,6-trifluorohexyl]-5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N/N=C(\CCCCNC(=O)c1nc(-c2nccs2)sc1C1CC1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C23H22F3N5O2S2/c24-23(25,26)16(30-31-19(32)15-6-2-1-3-7-15)8-4-5-11-27-20(33)17-18(14-9-10-14)35-22(29-17)21-28-12-13-34-21/h1-3,6-7,12-14H,4-5,8-11H2,(H,27,33)(H,31,32)/b30-16+ |
| InChIKey | HZSLLFKQAOCKIU-OKCVXOCRSA-N |
| XLogP | 5.39 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|