C17H27N — CID 126582814
(E)-3,6-dimethyl-N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]-5-methylidenehept-3-en-2-imine (PubChem CID 126582814) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is (E)-3,6-dimethyl-N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]-5-methylidenehept-3-en-2-imine.
| Compound Name | (E)-3,6-dimethyl-N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]-5-methylidenehept-3-en-2-imine |
|---|---|
| PubChem CID | 126582814 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | (E)-3,6-dimethyl-N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]-5-methylidenehept-3-en-2-imine |
| SMILES | C=C/C=C(\C)[C@@H](C)/N=C(C)/C(C)=C/C(=C)C(C)C |
| InChI | InChI=1S/C17H27N/c1-9-10-13(4)16(7)18-17(8)15(6)11-14(5)12(2)3/h9-12,16H,1,5H2,2-4,6-8H3/b13-10+,15-11+,18-17+/t16-/m1/s1 |
| InChIKey | XBUHIGKKJADBKS-WXKZMUEKSA-N |
| XLogP | 5.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|