C20H18F3N3O2S2 — CID 126582837
5-benzyl-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide (PubChem CID 126582837) has the molecular formula C20H18F3N3O2S2 and a molecular weight of 453.51 g/mol. Its IUPAC name is 5-benzyl-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-benzyl-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126582837 |
| Molecular Formula | C20H18F3N3O2S2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 5-benzyl-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCCC(=O)C(F)(F)F)c1nc(-c2nccs2)sc1Cc1ccccc1 |
| InChI | InChI=1S/C20H18F3N3O2S2/c21-20(22,23)15(27)8-4-5-9-24-17(28)16-14(12-13-6-2-1-3-7-13)30-19(26-16)18-25-10-11-29-18/h1-3,6-7,10-11H,4-5,8-9,12H2,(H,24,28) |
| InChIKey | JJZFDILZILDRTQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|