C17H20F3N3O2S2 — CID 126582841
5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide (PubChem CID 126582841) has the molecular formula C17H20F3N3O2S2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126582841 |
| Molecular Formula | C17H20F3N3O2S2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-N-(6,6,6-trifluoro-5-oxohexyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)Cc1sc(-c2nccs2)nc1C(=O)NCCCCC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H20F3N3O2S2/c1-10(2)9-11-13(23-16(27-11)15-22-7-8-26-15)14(25)21-6-4-3-5-12(24)17(18,19)20/h7-8,10H,3-6,9H2,1-2H3,(H,21,25) |
| InChIKey | AZLBBFOVLFWKTC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|