About 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate
4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate (PubChem CID 126582901) has the molecular formula C15H19F3O5S
and a molecular weight of 368.37 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate |
| PubChem CID | 126582901 |
| Molecular Formula | C15H19F3O5S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCC2(C(F)(F)F)OCCO2)cc1 |
| InChI | InChI=1S/C15H19F3O5S/c1-12-4-6-13(7-5-12)24(19,20)23-9-3-2-8-14(15(16,17)18)21-10-11-22-14/h4-7H,2-3,8-11H2,1H3 |
| InChIKey | CXSFUFRQCPKUBL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate?
The IUPAC name of 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate (CID 126582901) is 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate.
What is the SMILES notation for 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate?
The canonical SMILES for 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCCCC2(C(F)(F)F)OCCO2)cc1.
What is the InChIKey of 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate?
The InChIKey is CXSFUFRQCPKUBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F3O5S/c1-12-4-6-13(7-5-12)24(19,20)23-9-3-2-8-14(15(16,17)18)21-10-11-22-14/h4-7H,2-3,8-11H2,1H3.
What are the key properties of 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate?
4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate has a molecular weight of 368.37 g/mol, XLogP of 3.18, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(trifluoromethyl)-1,3-dioxolan-2-yl]butyl 4-methylbenzenesulfonate is sourced from PubChem (CID 126582901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).