C9H18N2 — CID 126582985
(3R)-1,2,2,4-tetramethyl-3,4-dihydropyridin-3-amine (PubChem CID 126582985) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (3R)-1,2,2,4-tetramethyl-3,4-dihydropyridin-3-amine.
| Compound Name | (3R)-1,2,2,4-tetramethyl-3,4-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 126582985 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (3R)-1,2,2,4-tetramethyl-3,4-dihydropyridin-3-amine |
| SMILES | CC1C=CN(C)C(C)(C)[C@@H]1N |
| InChI | InChI=1S/C9H18N2/c1-7-5-6-11(4)9(2,3)8(7)10/h5-8H,10H2,1-4H3/t7?,8-/m1/s1 |
| InChIKey | STKQISWEONMBMZ-BRFYHDHCSA-N |
| XLogP | 1.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |