C23H27NO3 — CID 126583072
(3E,4E)-4-ethylidene-5-[(2E,4Z)-6-hydroxyhepta-2,4,6-trien-3-yl]-5-[(3E,5E)-6-hydroxyhepta-1,3,5-trien-3-yl]-3-prop-2-enylidenepyrrolidin-2-one (PubChem CID 126583072) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is (3E,4E)-4-ethylidene-5-[(2E,4Z)-6-hydroxyhepta-2,4,6-trien-3-yl]-5-[(3E,5E)-6-hydroxyhepta-1,3,5-trien-3-yl]-3-prop-2-enylidenepyrrolidin-2-one.
| Compound Name | (3E,4E)-4-ethylidene-5-[(2E,4Z)-6-hydroxyhepta-2,4,6-trien-3-yl]-5-[(3E,5E)-6-hydroxyhepta-1,3,5-trien-3-yl]-3-prop-2-enylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 126583072 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (3E,4E)-4-ethylidene-5-[(2E,4Z)-6-hydroxyhepta-2,4,6-trien-3-yl]-5-[(3E,5E)-6-hydroxyhepta-1,3,5-trien-3-yl]-3-prop-2-enylidenepyrrolidin-2-one |
| SMILES | C=C/C=C1/C(=O)NC(/C(C=C)=C/C=C(\C)O)(C(/C=C\C(=C)O)=C/C)/C1=C/C |
| InChI | InChI=1S/C23H27NO3/c1-7-11-20-21(10-4)23(24-22(20)27,18(8-2)14-12-16(5)25)19(9-3)15-13-17(6)26/h7-15,25-26H,1-2,6H2,3-5H3,(H,24,27)/b15-13-,16-12+,18-14+,19-9+,20-11+,21-10+ |
| InChIKey | CPOKZYZXRYOLRH-ZVPODCJISA-N |
| XLogP | 5.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|