About N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine
N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine (PubChem CID 126583192) has the molecular formula C15H22BrNO
and a molecular weight of 312.25 g/mol. Its IUPAC name is N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine |
| PubChem CID | 126583192 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(CCC)c2c(c1Br)OCC2 |
| InChI | InChI=1S/C15H22BrNO/c1-3-5-11-9-12(10-17-7-4-2)14(16)15-13(11)6-8-18-15/h9,17H,3-8,10H2,1-2H3 |
| InChIKey | VKEAFLTVPWMWRX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine?
The IUPAC name of N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine (CID 126583192) is N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine.
What is the SMILES notation for N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine?
The canonical SMILES for N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine is CCCNCc1cc(CCC)c2c(c1Br)OCC2.
What is the InChIKey of N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine?
The InChIKey is VKEAFLTVPWMWRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrNO/c1-3-5-11-9-12(10-17-7-4-2)14(16)15-13(11)6-8-18-15/h9,17H,3-8,10H2,1-2H3.
What are the key properties of N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine?
N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine has a molecular weight of 312.25 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(7-bromo-4-propyl-2,3-dihydro-1-benzofuran-6-yl)methyl]propan-1-amine is sourced from PubChem (CID 126583192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).