C15H23NO — CID 126583250
(2E,4E,6Z)-1-(propan-2-ylamino)-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-4-ol (PubChem CID 126583250) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (2E,4E,6Z)-1-(propan-2-ylamino)-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-4-ol.
| Compound Name | (2E,4E,6Z)-1-(propan-2-ylamino)-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-4-ol |
|---|---|
| PubChem CID | 126583250 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2E,4E,6Z)-1-(propan-2-ylamino)-5-prop-1-en-2-ylnona-2,4,6,8-tetraen-4-ol |
| SMILES | C=C/C=C\C(C(=C)C)=C(O)\C=C\CNC(C)C |
| InChI | InChI=1S/C15H23NO/c1-6-7-9-14(12(2)3)15(17)10-8-11-16-13(4)5/h6-10,13,16-17H,1-2,11H2,3-5H3/b9-7-,10-8+,15-14+ |
| InChIKey | MSWOCFJEQZAACU-MXJAXNGNSA-N |
| XLogP | 3.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|