C15H28N2O2 — CID 126583265
N-[(2E,4Z)-3-(methylaminomethyl)-6-[(2-methylpropan-2-yl)oxy]octa-2,4-dienyl]formamide (PubChem CID 126583265) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[(2E,4Z)-3-(methylaminomethyl)-6-[(2-methylpropan-2-yl)oxy]octa-2,4-dienyl]formamide.
| Compound Name | N-[(2E,4Z)-3-(methylaminomethyl)-6-[(2-methylpropan-2-yl)oxy]octa-2,4-dienyl]formamide |
|---|---|
| PubChem CID | 126583265 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | N-[(2E,4Z)-3-(methylaminomethyl)-6-[(2-methylpropan-2-yl)oxy]octa-2,4-dienyl]formamide |
| SMILES | CCC(/C=C\C(=C/CNC=O)CNC)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-6-14(19-15(2,3)4)8-7-13(11-16-5)9-10-17-12-18/h7-9,12,14,16H,6,10-11H2,1-5H3,(H,17,18)/b8-7-,13-9+ |
| InChIKey | VXLGQACNTPIOBI-XTYDYKDCSA-N |
| XLogP | 2.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|