About (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine
(5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine (PubChem CID 126583286) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine.
Molecular Properties
| Compound Name | (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine |
| PubChem CID | 126583286 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine |
| SMILES | C=C1NCN=C/C1=C/C=C(/C)CC |
| InChI | InChI=1S/C11H16N2/c1-4-9(2)5-6-11-7-12-8-13-10(11)3/h5-7,13H,3-4,8H2,1-2H3/b9-5-,11-6- |
| InChIKey | OENKUZBNGRAPLA-WFMPKDELSA-N |
| XLogP | 2.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine?
The IUPAC name of (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine (CID 126583286) is (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine.
What is the SMILES notation for (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine?
The canonical SMILES for (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine is C=C1NCN=C/C1=C/C=C(/C)CC.
What is the InChIKey of (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine?
The InChIKey is OENKUZBNGRAPLA-WFMPKDELSA-N. The full InChI is InChI=1S/C11H16N2/c1-4-9(2)5-6-11-7-12-8-13-10(11)3/h5-7,13H,3-4,8H2,1-2H3/b9-5-,11-6-.
What are the key properties of (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine?
(5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine has a molecular weight of 176.26 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-6-methylidene-5-[(Z)-3-methylpent-2-enylidene]-1,2-dihydropyrimidine is sourced from PubChem (CID 126583286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).